Совокупность реакций органических соединений

Теория к заданию 25 из ЕГЭ по химии

Качественные реакции на неорганические вещества и ионы

Качественные реакции на катионы и анионы некоторых неорганических веществ

Качественные реакции на анионы.

Анион Условие, реактив, катион Признаки и сокращенное ионное уравнение реакции
$Cl^{-}$ Нитрат серебра $Ag^{+}$ Белый творожистый осадок:$Ag^{+}+Cl^{-}→AgCl↓$
$Br^{-}$ Нитрат серебра $Ag^{+}$ Желтоватый творожистый осадок: $Ag^{+}+Br^{-}→AgBr↓$
$I^{-}$ Нитрат серебра $Ag^{+}$ Желтый творожистый осадок: $Ag^{+}+I^{–}→AgI↓$
$SO_4^{2-}$ Растворимые соли бария $Ba^{2+}$ Белый осадок: $Ba^{2+}+SO_4^{2-}→BaSO_4↓$
$NO_3^{-}$ $H_2SO_4(конц)$ и $Cu$ Выделение бурого газа: $Cu+NO_3^{-}+2H^{+}=Cu^{2+}+NO_2↑+H_2O$
$PO_4^{3-}$ Нитрат серебра $Ag^{+} Ярко-желтый осадок:$3Ag^{+}+PO_4^{3-}→Ag_3PO_4↓$
$CrO_4^{2-}$ Растворимые соли бария $Ba^{2+}$ Желтый осадок: $Ba^{2+}+CrO_4^{2-}=BaCrO_4↓$
$S^{2-}$ Растворимые соли меди $Cu^{2+}$ Черный осадок: $Cu^{2+}+S^{2–}=CuS↓$
$CO_3^{2-}$ Кислоты $H^{+}$ Выделение газа без запаха: $2H^{+}+CO_3^{2-}=H_2O+CO_2↑$
$OH^{-}$ Лакмус Синий цвет раствора
Фенолфталеин Малиновый цвет раствора
Метиловый оранжевый Желтый цвет раствора

Качественные реакции на катионы.

Катион Условие, реактив, анион Признаки, сокращенное ионное уравнение реакции
$H^{+}$ Лакмус Красный цвет раствора
Метиловый оранжевый Розовый цвет раствора
$NH_4^{+}$ Щелочь, $OH^{–}$, $t°$ Выделение газа с резким запахом: $NH_4^{+}+OH^{-}=NH_3↑+H_2O$
$Ag^{+}$ Соляная кислота, растворы хлоридов, $Cl^{–} Белый творожистый осадок: $Ag^{+}+Cl^{–}→AgCl↓$
$Li^{+}$ Пламя Красное окрашивание
$Na^{+}$ Пламя Желтое окрашивание
$K^{+}$ Пламя Фиолетовое окрашивание
$Ca^{2+}$ Пламя Кирпично-красное окрашивание
Растворы карбонатов, $CO_3^{2−}$ Белый осадок: $Ca^{2+}+CO_3^{2-}→CaCO_3↓$
$Ba^{2+}$ Пламя Желто-зеленое окрашивание
Серная кислота, растворы сульфатов, $SO_4^{2−}$ Белый (мелкокристаллический) осадок: $Ba^{2+}+SO_4^{2-}→BaSO_4↓$
$Cu^{2+}$ Пламя Зеленое окрашивание
Вода Гидратированные ионы $Cu^{2+}$ имеют голубую окраску
Щелочь, $OH^{–}$ Синий осадок: $Cu^{2+}+2OH^{-}=Cu(OH)_2↓$
$Fe^{2+}$ Щелочь, $OH^{–}$ Зеленоватый осадок: $Fe^{2+}+2OH^{–}=Fe(OH)_2↓$
Красная кровяная соль $K_3, Fe(CN)_6^{3−}$ Синий осадок (турнбулева синь): $3Fe^{2+}+2^{3-}=Fe_3_2↓$
$Fe^{3+}$ Щелочь, $OH^{–}$ Бурый осадок: $Fe^{3+}+3OH^{–}=Fe(OH)_3↓$
Роданид аммония $NH_4SCN, SCN^{–}$ Кроваво-красный осадок: $3Fe^{3+}+3CNS^{-}⇄Fe(SCN)_3↓$
$Fe^{3+}$ Желтая кровяная соль $K_4$ Темно-синий осадок (берлинская лазурь): $4Fe^{3+}+3^{4–}=Fe_4_3↓$
$Al^{3+}$ Щелочь, $OH^{–}$ Желеобразный осадок белого цвета, растворяется в избытке раствора щелочи: $Al^{3+}+3OH^{–}=Al(OH)_3↓$
Вещество Реактив, условие Признаки реакции
$CH_2=CH_2$ Раствор $KMnO_4, H^{+}$ Обесцвечивание раствора
Раствор $Br_2$ Обесцвечивание раствора
$C_2H_5OH$ $CuO$ Изменение цвета проволоки, выделение паров с фруктовым запахом
$Cu(OH)_2$ Образование ярко-синего раствора
Раствор $Br_2$ Выпадение белого осадка
Раствор $FeCl_3$ Фиолетовое окрашивание
$Cu(OH)_2, t°$ Образование красного осадка $Cu_2O$
$Ag_2O, t°$ Образование «серебряного зеркала»
$CH_3COOH$ Лакмус Красное окрашивание
Раствор $Na_2CO_3$ Выделение газа
$HCOOH$ Лакмус Красное окрашивание
Раствор $KMnO_4, H^{+}$ Обесцвечивание раствора
Раствор $Na_2CO_3$ Выделение газа
$C_{17}H_{33}COOH$ Раствор $Br_2$ Обесцвечивание раствора
Раствор $KMnO_4$ Обесцвечивание раствора
$C_{17}H_{35}COONa$ раствор мыла $H^{+}$ Образование белых хлопьев
$C_{6}H_{12}O_6$ $Cu(OH)_2$ Ярко-синее окрашивание; при нагревании образование красного осадка
$Ag_2O$ Образование «серебряного зеркала»
$(C_{6}H_{10}O_5)_n$ крахмал Раствор $I_2$ Синее окрашивание
Раствор $Br_2$ Выпадение белого осадка
Белок яичный (раствор) $HNO_3$ Образование осадка желтого цвета
$Cu(OH)_2$ Фиолетовое окрашивание

Примеры качественных реакций на катионы

Катион Воздействие и реактив Наблюдаемая реакция
Li+{\displaystyle {{\ce {Li^{+}}}}} Пламя Карминово-красное окрашивание
Na+{\displaystyle {{\ce {Na^{+}}}}} Пламя Жёлтое окрашивание
K+{\displaystyle {{\ce {K^{+}}}}} Пламя Фиолетовое окрашивание
Ca2+{\displaystyle {\ce {Ca^{2+}}}} Пламя Кирпично-красное окрашивание
Sr2+{\displaystyle {{\ce {Sr^{2+}}}}} Пламя Карминово-красное окрашивание
Ba2+{\displaystyle {{\ce {Ba^{2+}}}}} 1. Пламя

2. SO42−{\displaystyle {\ce {SO_4^{2-}}}}

1. Жёлто-зелёное окрашивание

2. Выпадение белого осадка, не растворимого в кислотах Ba2++SO42−→BaSO4↓{\displaystyle {\mathsf {Ba^{2+}+SO_{4}^{2-}\rightarrow BaSO_{4}\downarrow }}}

Cu2+{\displaystyle {{\ce {Cu^{2+}}}}} Вода Гидратированные ионы Cu2+{\displaystyle {{\ce {Cu^{2+}}}}} имеют голубую окраску
Pb2+{\displaystyle {{\ce {Pb^{2+}}}}} S2−{\displaystyle {{\ce {S^{2-}}}}} Выпадение чёрного осадка сульфида свинца(II)

Pb2++S2−→PbS↓{\displaystyle {\mathsf {Pb^{2+}+S^{2-}\rightarrow PbS\downarrow }}}

Ag+{\displaystyle {{\ce {Ag^{+}}}}} Cl−{\displaystyle {{\ce {Cl^{-}}}}} Выпадение белого осадка хлорида серебра

Ag++Cl−→AgCl↓{\displaystyle {\mathsf {Ag^{+}+Cl^{-}\rightarrow AgCl\downarrow }}}

Fe2+{\displaystyle {\ce {Fe^{2+}}}} Гексацианоферрат (III) калия K3Fe(CN)6{\displaystyle {\ce {K_3}}} Выпадение синего осадка берлинской лазури

K++Fe2++Fe(CN)63−→KFeFe(CN)6↓{\displaystyle {\mathsf {K^{+}+Fe^{2+}+^{3-}\rightarrow KFe\downarrow }}}

Ni2+{\displaystyle {{\ce {Ni^{2+}}}}} Реактив Чугаева Выпадение красного осадка

Качественные реакции неорганических веществ на катионы, анионы, для газов и для щелочных металлов

Качественные реакции на катионы

Катион

Реактив

Реакция

Характерные признаки

Н+

Лакмус Метилоранж

Красное окрашиваниеРозовое окрашивание

Ва2+

Растворимые сульфаты, серная кислота. Пламя спиртовки.

Ba2+ + SO42- = BaSO4

Белый мелкодисперсный осадок BaSO4, нерастворимый в H2O и HNO3.Желто-зеленая окраска пламени.

Ag+

Растворимые хлориды, соляная кислота

Ag+ + Cl- = AgCl↓

Белый творожистый осадок AgCl, нерастворимый в H2O и HNO3

NH4+

Раствор щелочи, нагревание, влажная фильтровальная бумажка, пропитанная лакмусом или фенолфталеином; палочка, смоченная HCl(конц)

Специфический запах аммиака. Изменение окраски бумажки. Палочка, смоченная HCl(конц) «дымит»

Al3+

Растворы щелочи, кислоты

Al3+ + 3OH- = Al(OH)3↓ Al(OH)3 + 3H+ = Al3+ + 3H2O Al(OH)3 + OH- = [Al(OH)4]-

Белый осадок Al(OH)3, растворимый в кислоте в избытке щелочи

Zn2+

Растворы щелочи, кислоты

Zn2+ + 2OH- = Zn(OH)2↓ Zn(OH)2 + 2H+ = Zn2+ + 2H2O Zn(OH)2 + 2OH- = [Zn(OH)4]2-

Белый осадок Zn(OH)2, растворимый в кислоте в избытке щелочи

Mg2+

Раствор щелочи

Mg2+ + 2OH- = Mg(OH)2

Белый осадок Mg(OH)2, нерастворимый в избытке щелочи

Cr3+

Растворы щелочи, кислоты

Cr3+ + 3OH- = Cr(OH)3↓ Cr(OH)3 + 3H+ = Cr3+ + 3H2O Cr(OH)3 + OH- = [Cr(OH)4]-

Cеро-зеленый осадок Cr(OH)3, растворимый в кислоте в избытке щелочи

Fe2+

Раствор красной кровяной соли K3[Fe(CN)6]

3Fe2++2[Fe(CN)6]3- = Fe3[Fe(CN)6]2

Образование турнбулевой сини Fe3[Fe(CN)6]2

Fe3+

Раствор роданида аммония NH4CNS Раствор желтой кровяной соли K4[Fe(CN)6]

Fe3+ + 3CNS- = Fe(CNS)3 4Fe3+ + 3[Fe(CN)6]4+ = Fe4[Fe(CN)6]3

Кроваво-красное окрашивание раствора Образование берлинской лазури Fe4[Fe(CN)6]3

Cu2+

Раствор щелочи с последующим нагреванием

Cu2+ + 2OH- = Cu(OH)2↓ Cu(OH)2 → CuO + H2O

Ярко-голубой студенистый осадок, нерастворимый в избытке щелочи, разлагающийся при нагревании на черный осадок CuO и воду

Качественные реакции на анионы

OH-

Лакмус

Синее окрашивание

Фенолфталеин

Малиновое окрашивание

Метилоранж

Желтое окрашивание

Cl-

Раствор нитрата серебра AgNO3

Ag+ + Cl- = AgCl↓

Белый творожистый осадок, нерастворимый в H2O и HNO3

Br-

Раствор нитрата серебра AgNO3

Ag+ + Br- = AgBr↓

Светло-желтый осадок, нерастворимый в H2O и HNO3

I-

Раствор нитрата серебра AgNO3

Ag+ + I- = AgI↓

Желтый осадок, нерастворимый в H2O и HNO3

NO3

Концентрированная серная кислота и медная стружка при нагревании

H2SO4+ 2NH4NO3=(NH4)2SO4 + 2HNO3 4HNO3+Cu → Cu(NO3)2+2NO2 +2H2O

Бурый газ (NO2), голубая окраска раствора

SO42-

Раствор соли бария

Ba2+ + SO42- = BaSO4

Белый мелкодисперсный осадок, нерастворимый в H2O и HNO3

SO32-

Сильная кислота

Газ с резким специфическим запахом

S2-

Раствор соли свинца

Pb2+ + S2- = PbS↓

Черно-бурый осадок

CO32-

Cильная кислота

Газ без цвета и запаха, не поддерживает горение

HCO3

PO43-

Раствор нитрата серебра в слабощелочной среде

3Ag+ + PO43- = Ag3PO4

Желтый осадок, растворимый в HNO3

HPO43-

3Ag+ + HPO42- = Ag3PO4↓ +H+

H2PO4

3Ag+ + H2PO4— = Ag3PO4 +2H+

Качественные реакции для газов

Вещество

Реактив

Реакция

Характерные признаки

Н2

О2 (сжигание)

2 + О2 = 2Н2О

Запотевание холодного предмета

О2

С (тлеющая лучинка)

С + О2 = СО2

Вспышка

Сl2

Бумажка, пропитанная крахмальным клейстером и раствором иодида калия

2KI + Cl2 = 2KCl + I2

Посинение бумажки

I2

Крахмальный клейстер

Синее окрашивание

СО2

Известковая вода

Са(ОН)2 + СО2 = СаСО3↓+ Н2О

Помутнение раствора

NH3

Хлороводород

NH3 + HCl = NH4Cl

Белый дым. Специфический запах NH3, образование белого дыма (NH4Cl)

Качественные реакции для щелочных металлов

Все соединения щелочных металлов определяют по цвету пламени:

Ba2+

желто-зеленое

K+ фиолетовое

Са2+

кирпично-красное

Li+ ярко-красное
Na+ желтое
Sr2+ карминово-красное

Дополнительные материалы

  • Решай задание 25 ЕГЭ по химии с ответами.
  • Теория по химии для подготовки к ЕГЭ
  • Таблица растворимости солей, кислот, оснований в воде

Правила растворимости химических соединений:

  1. Все нитраты являются растворимыми.
  2. Практически все соли калия, натрия и аммония растворимы.
  3. Все хлориды, бромиды и йодиды растворимы, за исключением галогенидов серебра, ртути (I) и свинца (II).
  4. Все сульфаты растворимы, за исключением сульфатов бария, стронция и свинца (II), которые являются нерастворимыми, и сульфатов кальция и серебра, которые являются умеренно растворимыми.
  5. Все карбонаты, сульфиты и фосфаты не растворяются за исключением карбонатов, сульфитов и фосфатов калия, натрия и аммония.
  6. Все сульфиды нерастворимы, за исключением сульфидов щелочных металлов, щелочноземельных металлов и аммония.
  7. Все гидроксиды нерастворимы за исключением гидроксидов щелочных металлов. Гидроокиси стронция, кальция и бария умеренно растворимы.

Качественные реакции органических соединений (Таблица)

Таблица качественные реакции органических соединений

Органическое соединение Реактив (реагент) Качественные реакции органических соединений Запах
Алканы Действие пламя Обычно определяют путем исключения. Низшие алканы горят голубоватым пламенем Есть запах
Алкены С=С
  • 1) Бромная вода
  • 2) Раствор КМnO4
  • 3) Горение
  1. 1) Обесцвечивание раствора
  2. 2) Обесцвечивание раствора, выпадение бурого осадка МnО2↓
  3. 3) Горят слегка желтоватым пламенем (частицы углерода)
Есть запах
Алкины CH=CH
или R-C=CH
Ag2O (NH2 · H2O) Бледно-желтый осадок Ag3O3↓
CuCl (NH3 · H2O) Красный осадок Cu2O2↓
Толуол KMnO4 (раствор)
(кислотный раствор)
Обесцвечивание раствора (при нагревании)
Бензол Горение Качественную реакцию бензола обычно определяют путем исключения. Горит коптящим пламенем Есть запах
Фенол
  • 1) Бромная вода
  • 2) Раствор Na2СО3
  • 3) FeCl3
  1. 1) Обесцвечивание, выпадение бело-желтого осадка трибромфенола
  2. 2) Выделение углекислого газа
  3. 3) Фиолетовое окрашивание
Есть запах
Спирты
  • 1) Na
  • 2) Горение
  • 3) Мерная горячая прокаленная Сu-проволока
  1. 1) Выделение водорода
  2. 2) Горят светлым голубоватым пламенем
  3. 3) Восстановление красной окраски у прокаленной горячей медной проволоки
Есть запах
Многоатомные спирты Сu(ОН)2 + NaOH Синее окрашивание — образование глицератов и другое Нет
Амины 1) Лакмус
2) HHal
1) В водном растворе — синее окрашивание
2) Образуют соли с галогеноводородами — после выпаривания твердый осадок
Есть запах
Анилин 1) Бромная вода
2) HHal
1) Обесцвечивание бромной воды, выпадение осадка триброманилина
2) После упаривания твердый осадок — соль гидрогалогенида анилина
Есть запах
Альдегиды -CHO 1) Аg2О
2) Сu(ОН)2
1) Реакция серебряного зеркала
2) Выпадение красного осадка Сu2O↓
Есть запах
Карбоновые кислоты -COOH 1) Лакмус
2) Na2CO2 (раствор)
1) Красное окрашивание
2) Выделение газа CO2↑
Есть запах
Муравьиная кислота Ag2O (NH2 · H2O) Реакция серебряного зеркала (при нагревании) Есть запах
Олеиновая кислота Br2 (раствор) Обесцвечивание Есть запах
Уксусная кислота Na2CO2 (раствор) Выделение газа CO2↑ , характерный запах уксуса Есть запах
Крахмал Раствор I2 в KI или спиртовой раствор иода При качественной реакции на органическое соединение крахмал происходит синее окрашивание Нет
Белки Конц. HNO3 Желтое окрашивание, при добавлении щелочного раствора — оранжевое Нет
Глюкоза -CHO
  • Cu(OH)2, tº (свежеприготовленный из 2х капель CuSO4 и 1 мл NaOH)
  • 1) Без tº
  • 2) С tº
1) Образование хелата
2) Выпадение красного осадка Cu2O
Нет
Сахароза Cu(OH)2  взвесь Растворение осадка Нет
Cl-производные Cu + пламя Зеленое окрашивание пламени парами CuCl2 Нет
Мыло (стеарат натрия) 1) Лакмус
2) HCl
1) Щелочная среда в результате гидролиза окрашивается в синий цвет
2) Белый осадок ввиде хлопьев стеариновой кислоты
Нет

Совокупность реакций органических соединений

Качественные реакции органических веществ

Вещество, функциональная группа

Реактив

Схема реакции

Характерные признаки

Непредельные углеводороды (алкены, алкины, диены), кратные связи

р-р KMnO4 (розовый)

СН2=СН2 + Н2О + КMnO4 → КОН + MnO2↓+ СН2(ОН)-СН2(ОН)

обесцвечивание р-ра

р-р I2 (бурый)

СН2=СН-CН3 + I2 → СН2(I)-СН(I)-CH3

обесцвечивание р-ра

р-р Br2 (желтый)

СН2=СН2 + Br2 → СН2(Br)-СН2(Br)

обесцвечивание р-ра

Ацетилен

аммиачный р-р Ag2O

образование осадка (ацетиленид серебра) белого цвета (взрывоопасен)

Бензол

нитрующая смесь HNO3 + H2SO4

tC, H2SO4(конц.) C6Н6 + HNO3 → C6H5-NO2 + H2O

образование тяжелой жидкости светло-желтого цвета с запахом горького миндаля

Толуол

р-р KMnO4 (розовый)

C6Н5-СН3 + KMnO4 + H2SO4 → C6Н5-COOH + H2O + K2SO4 + MnSO4

обесцвечивание р-ра

Фенол (карболовая кислота)

р-р FeCl3 (светло-желтый)

C6Н5OH + FeCl3 → (C6Н5O)3Fe + HCl

окрашивание р-ра в фиолетовый цвет

насыщенный р-р Br2(бромная вода)

C6Н5OH + 2Br2 → C6Н2Br3OH↓ + HBr

образование белого осадка со специфическим запахом

Анилин (аминобензол)

р-р хлорной извести CaOCl2 (бесцветный)

окрашивание р-ра в фиолетовый цвет

Этанол

насыщенный р-р I2 + р-р NaOH

C2H5OH + I2 + NaOH → CHI3↓ + HCOONa + NaI + H2O

образование мелкокристаллического осадка СНI3 светло-желтого цвета со специфическим запахом

CuO (прокаленная медная проволока)

C2H5OH + CuO → Cu↓ + CH3-CHO + H2O

выделение металлической меди, специфический запах ацетальдегида

Гидроксогруппа (спирты, фенол, гидроксикислоты)

Металлический Na

выделение пузырьков газа (Н2), образование бесцветной студенистой массы

Эфиры (простые и сложные)

Н2О (гидролиз) в присутствии NaOH при нагревании

CH3-C(O)-O-C2H5 + H2O CH3COOH + C2H5OH

специфический запах

Многоатомные спирты, глюкоза

Свежеосажденный гидроксид меди (II) в сильно щелочной среде

ярко-синее окрашивание р-ра

Карбонильная группа – СНО (альдегиды, глюкоза)

Аммиачный р-р Ag2O

образование блестящего налета Ag («серебряное зеркало») на стенках сосудов

Свежеосажденный Сu(OH)2

R-CHO + Cu(OH)2 → R-COOH + Cu2O↓ + H2O

образование красного осадка Сu2O

Карбоновые кислоты

лакмус

окрашивание р-ра в розовый цвет

р-р Na2CO3

выделение СО2

спирт +H2SO4(конц.)

R-COOH + HO-R1 RC(O)OR1 + H2O

специфический запах образующегося сложного эфира

Муравьиная кислота

Свежеосажденный Сu(OH)2

образование красного осадка Сu2O

Аммиачный р-р Ag2O

«серебряное зеркало» на стенках сосуда

Олеиновая кислота

р-р KMnO4 (розовый) или I2 (бурый) или Br2(желтый)

C17H33COOH + KMnO4 + H2O → C8H17-CH(OH)-CH(OH)-(CH2)7-COOH + MnO2↓ + KOH C17H33COOH + I2 → C8H17-CH(I)-CH(I)-(CH2)7-COOH

обесцвечивание р-ра

Ацетаты (соли уксусной кислоты)

р-р FeCl3

CH3COONa + FeCl3 → (CH3COO)3Fe + NaCl

окрашивание р-ра в красно-бурый цвет

Стеарат натрия (мыло)

Н2О (гидролиз) + фенолфталеин

C17H35COONa + H2O C17H35OOH↓ + NaOH

окрашивание р-ра в малиновый цвет

насыщенный р-р соли кальция

C17H35COONa + Ca2+ (C17H35COO)2Ca↓ + Na+

образование серого осадка

Концентрированная неорганическая кислота

C17H35COONa + H+ C17H355COOH↓ + Na+

образование белого осадка

Белок

пламя

реакция горения

запах «паленого», жженых перьев

НNO3 (конц.);t, °С

ксантопротеиновая реакция (происходит нитрование бензольных колец в молекуле белка)

  • без нагревания – появляется желтое окрашивание р-ра;
  • при нагревании и добавлении раствора аммиака белок окрашивается в желтый цвет

Свежеосажденный Сu(OH)2

биуретовая реакция (образуется комплексное соединение)

сине-фиолетовое окрашивание р-ра

Михаил Фирсов
Оцените автора
( Пока оценок нет )
Добавить комментарий